C11H14FNO2 — CID 169440701
N-(4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxy-N-propan-2-ylacetamide (PubChem CID 169440701) has the molecular formula C11H14FNO2 and a molecular weight of 217.19 g/mol. Its IUPAC name is N-(4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxy-N-propan-2-ylacetamide.
| Compound Name | N-(4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxy-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 169440701 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(4-fluoro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)-2-hydroxy-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)CO)[13c]1[13cH][13cH][13c](F)[13cH][13cH]1 |
| InChI | InChI=1S/C11H14FNO2/c1-8(2)13(11(15)7-14)10-5-3-9(12)4-6-10/h3-6,8,14H,7H2,1-2H3/i3+1,4+1,5+1,6+1,9+1,10+1 |
| InChIKey | RISGISSUGUGJMO-MSQIWANRSA-N |
| XLogP | 1.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |