C11H20FNO7P2S2 — CID 88710742
N-(4-fluorophenyl)-N-propan-2-ylacetamide;bis(trihydroxy(sulfanylidene)-λ5-phosphane) (PubChem CID 88710742) has the molecular formula C11H20FNO7P2S2 and a molecular weight of 423.36 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N-propan-2-ylacetamide;bis(trihydroxy(sulfanylidene)-λ5-phosphane).
| Compound Name | N-(4-fluorophenyl)-N-propan-2-ylacetamide;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
|---|---|
| PubChem CID | 88710742 |
| Molecular Formula | C11H20FNO7P2S2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | N-(4-fluorophenyl)-N-propan-2-ylacetamide;bis(trihydroxy(sulfanylidene)-λ5-phosphane) |
| SMILES | CC(=O)N(c1ccc(F)cc1)C(C)C.OP(O)(O)=S.OP(O)(O)=S |
| InChI | InChI=1S/C11H14FNO.2H3O3PS/c1-8(2)13(9(3)14)11-6-4-10(12)5-7-11;2*1-4(2,3)5/h4-8H,1-3H3;2*(H3,1,2,3,5) |
| InChIKey | FVPXEIAJRNZSPY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|