C11H16NO3PS2 — CID 149151907
2-dihydroxyphosphinothioylsulfanyl-N-phenyl-N-propan-2-ylacetamide (PubChem CID 149151907) has the molecular formula C11H16NO3PS2 and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-dihydroxyphosphinothioylsulfanyl-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-dihydroxyphosphinothioylsulfanyl-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 149151907 |
| Molecular Formula | C11H16NO3PS2 |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-dihydroxyphosphinothioylsulfanyl-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)CSP(O)(O)=S)c1ccccc1 |
| InChI | InChI=1S/C11H16NO3PS2/c1-9(2)12(10-6-4-3-5-7-10)11(13)8-18-16(14,15)17/h3-7,9H,8H2,1-2H3,(H2,14,15,17) |
| InChIKey | VSTLKYXWUQENTK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|