C19H28N2O3 — CID 6569964
(5S)-5-methyl-5-[4-(7-methyloctoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 6569964) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (5S)-5-methyl-5-[4-(7-methyloctoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[4-(7-methyloctoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 6569964 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (5S)-5-methyl-5-[4-(7-methyloctoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | CC(C)CCCCCCOc1ccc([C@]2(C)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-14(2)8-6-4-5-7-13-24-16-11-9-15(10-12-16)19(3)17(22)20-18(23)21-19/h9-12,14H,4-8,13H2,1-3H3,(H2,20,21,22,23)/t19-/m0/s1 |
| InChIKey | ZNLZRICMGAJIBK-IBGZPJMESA-N |
| XLogP | 3.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|