C16H21NO2 — CID 137474488
7-(5-methylhexoxy)-1H-quinolin-2-one (PubChem CID 137474488) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 7-(5-methylhexoxy)-1H-quinolin-2-one.
| Compound Name | 7-(5-methylhexoxy)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 137474488 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 7-(5-methylhexoxy)-1H-quinolin-2-one |
| SMILES | CC(C)CCCCOc1ccc2ccc(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H21NO2/c1-12(2)5-3-4-10-19-14-8-6-13-7-9-16(18)17-15(13)11-14/h6-9,11-12H,3-5,10H2,1-2H3,(H,17,18) |
| InChIKey | IXIWEWJHGOEGSA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|