C27H35N3O3 — CID 56599011
7-[4-[4-(2-propan-2-yloxyphenyl)-1,4-diazepan-1-yl]butoxy]-1H-quinolin-2-one (PubChem CID 56599011) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 7-[4-[4-(2-propan-2-yloxyphenyl)-1,4-diazepan-1-yl]butoxy]-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-(2-propan-2-yloxyphenyl)-1,4-diazepan-1-yl]butoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 56599011 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 7-[4-[4-(2-propan-2-yloxyphenyl)-1,4-diazepan-1-yl]butoxy]-1H-quinolin-2-one |
| SMILES | CC(C)Oc1ccccc1N1CCCN(CCCCOc2ccc3ccc(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-21(2)33-26-9-4-3-8-25(26)30-16-7-15-29(17-18-30)14-5-6-19-32-23-12-10-22-11-13-27(31)28-24(22)20-23/h3-4,8-13,20-21H,5-7,14-19H2,1-2H3,(H,28,31) |
| InChIKey | OKJIXAFKUUQQCX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|