C26H31N3O2 — CID 135231666
7-[4-[4-[2-[(Z)-prop-1-enyl]phenyl]piperazin-1-yl]butoxy]-1H-quinolin-2-one (PubChem CID 135231666) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 7-[4-[4-[2-[(Z)-prop-1-enyl]phenyl]piperazin-1-yl]butoxy]-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-[2-[(Z)-prop-1-enyl]phenyl]piperazin-1-yl]butoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135231666 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 7-[4-[4-[2-[(Z)-prop-1-enyl]phenyl]piperazin-1-yl]butoxy]-1H-quinolin-2-one |
| SMILES | C/C=C\c1ccccc1N1CCN(CCCCOc2ccc3ccc(=O)[nH]c3c2)CC1 |
| InChI | InChI=1S/C26H31N3O2/c1-2-7-22-8-3-4-9-25(22)29-17-15-28(16-18-29)14-5-6-19-31-23-12-10-21-11-13-26(30)27-24(21)20-23/h2-4,7-13,20H,5-6,14-19H2,1H3,(H,27,30)/b7-2- |
| InChIKey | PJSDDTADDJBPPO-UQCOIBPSSA-N |
| XLogP | 4.54 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|