C14H17NO5Rf-2 — CID 177262297
7-(2-hydroxy-3-methanidyloxypropoxy)-1H-quinolin-2-one;methanol;rutherfordium (PubChem CID 177262297) has the molecular formula C14H17NO5Rf-2 and a molecular weight of 546.29 g/mol. Its IUPAC name is 7-(2-hydroxy-3-methanidyloxypropoxy)-1H-quinolin-2-one;methanol;rutherfordium.
| Compound Name | 7-(2-hydroxy-3-methanidyloxypropoxy)-1H-quinolin-2-one;methanol;rutherfordium |
|---|---|
| PubChem CID | 177262297 |
| Molecular Formula | C14H17NO5Rf-2 |
| Molecular Weight | 546.29 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 7-(2-hydroxy-3-methanidyloxypropoxy)-1H-quinolin-2-one;methanol;rutherfordium |
| SMILES | [CH2-]O.[CH2-]OCC(O)COc1ccc2ccc(=O)[nH]c2c1.[Rf] |
| InChI | InChI=1S/C13H14NO4.CH3O.Rf/c1-17-7-10(15)8-18-11-4-2-9-3-5-13(16)14-12(9)6-11;1-2;/h2-6,10,15H,1,7-8H2,(H,14,16);2H,1H2;/q2*-1; |
| InChIKey | WHUNSNJEAMOPNT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|