C20H29NO9Rf-2 — CID 177262319
1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;4-(2-hydroxy-3-methanidyloxypropoxy)-7-methoxy-1H-quinolin-2-one;rutherfordium (PubChem CID 177262319) has the molecular formula C20H29NO9Rf-2 and a molecular weight of 694.45 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;4-(2-hydroxy-3-methanidyloxypropoxy)-7-methoxy-1H-quinolin-2-one;rutherfordium.
| Compound Name | 1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;4-(2-hydroxy-3-methanidyloxypropoxy)-7-methoxy-1H-quinolin-2-one;rutherfordium |
|---|---|
| PubChem CID | 177262319 |
| Molecular Formula | C20H29NO9Rf-2 |
| Molecular Weight | 694.45 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | 1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;4-(2-hydroxy-3-methanidyloxypropoxy)-7-methoxy-1H-quinolin-2-one;rutherfordium |
| SMILES | [CH2-]OCC(O)COCCO.[CH2-]OCC(O)COc1cc(=O)[nH]c2cc(OC)ccc12.[Rf] |
| InChI | InChI=1S/C14H16NO5.C6H13O4.Rf/c1-18-7-9(16)8-20-13-6-14(17)15-12-5-10(19-2)3-4-11(12)13;1-9-4-6(8)5-10-3-2-7;/h3-6,9,16H,1,7-8H2,2H3,(H,15,17);6-8H,1-5H2;/q2*-1; |
| InChIKey | DQEICPCHYHQXRF-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|