C16H34O8Rf-2 — CID 177262277
1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;1-methanidyloxy-4-(2-propoxyethoxy)butan-2-ol;rutherfordium (PubChem CID 177262277) has the molecular formula C16H34O8Rf-2 and a molecular weight of 621.44 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;1-methanidyloxy-4-(2-propoxyethoxy)butan-2-ol;rutherfordium.
| Compound Name | 1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;1-methanidyloxy-4-(2-propoxyethoxy)butan-2-ol;rutherfordium |
|---|---|
| PubChem CID | 177262277 |
| Molecular Formula | C16H34O8Rf-2 |
| Molecular Weight | 621.44 g/mol |
| Exact Mass | 621.35 |
| IUPAC Name | 1-(2-hydroxyethoxy)-3-methanidyloxypropan-2-ol;1-methanidyloxy-4-(2-propoxyethoxy)butan-2-ol;rutherfordium |
| SMILES | [CH2-]OCC(O)CCOCCOCCC.[CH2-]OCC(O)COCCO.[Rf] |
| InChI | InChI=1S/C10H21O4.C6H13O4.Rf/c1-3-5-13-7-8-14-6-4-10(11)9-12-2;1-9-4-6(8)5-10-3-2-7;/h10-11H,2-9H2,1H3;6-8H,1-5H2;/q2*-1; |
| InChIKey | IIOPQLKQYFVTDY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|