C17H36O7Rf-2 — CID 177262241
4-methanidyloxybutane-1,3-diol;1-methanidyloxy-4-(4-propoxybutoxy)butan-2-ol;rutherfordium (PubChem CID 177262241) has the molecular formula C17H36O7Rf-2 and a molecular weight of 619.47 g/mol. Its IUPAC name is 4-methanidyloxybutane-1,3-diol;1-methanidyloxy-4-(4-propoxybutoxy)butan-2-ol;rutherfordium.
| Compound Name | 4-methanidyloxybutane-1,3-diol;1-methanidyloxy-4-(4-propoxybutoxy)butan-2-ol;rutherfordium |
|---|---|
| PubChem CID | 177262241 |
| Molecular Formula | C17H36O7Rf-2 |
| Molecular Weight | 619.47 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | 4-methanidyloxybutane-1,3-diol;1-methanidyloxy-4-(4-propoxybutoxy)butan-2-ol;rutherfordium |
| SMILES | [CH2-]OCC(O)CCO.[CH2-]OCC(O)CCOCCCCOCCC.[Rf] |
| InChI | InChI=1S/C12H25O4.C5H11O3.Rf/c1-3-7-15-8-4-5-9-16-10-6-12(13)11-14-2;1-8-4-5(7)2-3-6;/h12-13H,2-11H2,1H3;5-7H,1-4H2;/q2*-1; |
| InChIKey | HBEOSMOKOIZUEO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|