C16H21NO6 — CID 177262317
7-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]-1H-quinolin-2-one (PubChem CID 177262317) has the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]-1H-quinolin-2-one.
| Compound Name | 7-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 177262317 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 7-[2-hydroxy-3-(2-hydroxy-3-methoxypropoxy)propoxy]-1H-quinolin-2-one |
| SMILES | COCC(O)COCC(O)COc1ccc2ccc(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H21NO6/c1-21-7-12(18)8-22-9-13(19)10-23-14-4-2-11-3-5-16(20)17-15(11)6-14/h2-6,12-13,18-19H,7-10H2,1H3,(H,17,20) |
| InChIKey | NEELQUBMJZRYNC-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |