About 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one
7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one (PubChem CID 137474361) has the molecular formula C18H25NO2
and a molecular weight of 287.40 g/mol. Its IUPAC name is 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one |
| PubChem CID | 137474361 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one |
| SMILES | CC(CC(C)C(C)(C)C)Oc1ccc2ccc(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H25NO2/c1-12(18(3,4)5)10-13(2)21-15-8-6-14-7-9-17(20)19-16(14)11-15/h6-9,11-13H,10H2,1-5H3,(H,19,20) |
| InChIKey | HVSQHRHHEUGOER-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one?
The IUPAC name of 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one (CID 137474361) is 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one.
What is the SMILES notation for 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one?
The canonical SMILES for 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one is CC(CC(C)C(C)(C)C)Oc1ccc2ccc(=O)[nH]c2c1.
What is the InChIKey of 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one?
The InChIKey is HVSQHRHHEUGOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO2/c1-12(18(3,4)5)10-13(2)21-15-8-6-14-7-9-17(20)19-16(14)11-15/h6-9,11-13H,10H2,1-5H3,(H,19,20).
What are the key properties of 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one?
7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one has a molecular weight of 287.40 g/mol, XLogP of 4.37, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4,5,5-trimethylhexan-2-yloxy)-1H-quinolin-2-one is sourced from PubChem (CID 137474361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).