C14H14N3O6- — CID 2534969
2-[(4S)-4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 2534969) has the molecular formula C14H14N3O6- and a molecular weight of 320.28 g/mol. Its IUPAC name is 2-[(4S)-4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | 2-[(4S)-4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 2534969 |
| Molecular Formula | C14H14N3O6- |
| Molecular Weight | 320.28 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[(4S)-4-[4-(2-amino-2-oxoethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | C[C@@]1(c2ccc(OCC(N)=O)cc2)NC(=O)N(CC(=O)[O-])C1=O |
| InChI | InChI=1S/C14H15N3O6/c1-14(12(21)17(6-11(19)20)13(22)16-14)8-2-4-9(5-3-8)23-7-10(15)18/h2-5H,6-7H2,1H3,(H2,15,18)(H,16,22)(H,19,20)/p-1/t14-/m0/s1 |
| InChIKey | YGHFMUMNUYJCDA-AWEZNQCLSA-M |
| XLogP | -1.93 |
| TPSA | 141.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.28 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|