C24H40N2O3Si2 — CID 91744808
1,3-bis[tert-butyl(dimethyl)silyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 91744808) has the molecular formula C24H40N2O3Si2 and a molecular weight of 460.77 g/mol. Its IUPAC name is 1,3-bis[tert-butyl(dimethyl)silyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis[tert-butyl(dimethyl)silyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 91744808 |
| Molecular Formula | C24H40N2O3Si2 |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1,3-bis[tert-butyl(dimethyl)silyl]-5-ethyl-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(c2ccccc2)C(=O)N([Si](C)(C)C(C)(C)C)C(=O)N([Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C24H40N2O3Si2/c1-12-24(18-16-14-13-15-17-18)19(27)25(30(8,9)22(2,3)4)21(29)26(20(24)28)31(10,11)23(5,6)7/h13-17H,12H2,1-11H3 |
| InChIKey | RYNBCZIIFYLNMN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|