C16H20N2O5 — CID 165342736
5-ethyl-1,3-bis(methoxy(114C)methyl)-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 165342736) has the molecular formula C16H20N2O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 5-ethyl-1,3-bis(methoxy(114C)methyl)-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-ethyl-1,3-bis(methoxy(114C)methyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 165342736 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 5-ethyl-1,3-bis(methoxy(114C)methyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(c2ccccc2)C(=O)N([14CH2]OC)C(=O)N([14CH2]OC)C1=O |
| InChI | InChI=1S/C16H20N2O5/c1-4-16(12-8-6-5-7-9-12)13(19)17(10-22-2)15(21)18(11-23-3)14(16)20/h5-9H,4,10-11H2,1-3H3/i10+2,11+2 |
| InChIKey | DACOQFZGGLCXMA-QBHSWEOZSA-N |
| XLogP | 1.33 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|