C26H19FN2O5 — CID 41003640
(5R)-1-benzoyl-5-ethyl-3-(3-fluorobenzoyl)-5-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 41003640) has the molecular formula C26H19FN2O5 and a molecular weight of 458.45 g/mol. Its IUPAC name is (5R)-1-benzoyl-5-ethyl-3-(3-fluorobenzoyl)-5-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-1-benzoyl-5-ethyl-3-(3-fluorobenzoyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 41003640 |
| Molecular Formula | C26H19FN2O5 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (5R)-1-benzoyl-5-ethyl-3-(3-fluorobenzoyl)-5-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC[C@@]1(c2ccccc2)C(=O)N(C(=O)c2ccccc2)C(=O)N(C(=O)c2cccc(F)c2)C1=O |
| InChI | InChI=1S/C26H19FN2O5/c1-2-26(19-13-7-4-8-14-19)23(32)28(21(30)17-10-5-3-6-11-17)25(34)29(24(26)33)22(31)18-12-9-15-20(27)16-18/h3-16H,2H2,1H3/t26-/m1/s1 |
| InChIKey | IFCKVFSLABSWPK-AREMUKBSSA-N |
| XLogP | 3.95 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|