C20H23FN2O2 — CID 156601763
[3-(dimethylamino)-4-hydroxy-4-phenylpiperidin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 156601763) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is [3-(dimethylamino)-4-hydroxy-4-phenylpiperidin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [3-(dimethylamino)-4-hydroxy-4-phenylpiperidin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 156601763 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [3-(dimethylamino)-4-hydroxy-4-phenylpiperidin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | CN(C)C1CN(C(=O)c2cccc(F)c2)CCC1(O)c1ccccc1 |
| InChI | InChI=1S/C20H23FN2O2/c1-22(2)18-14-23(19(24)15-7-6-10-17(21)13-15)12-11-20(18,25)16-8-4-3-5-9-16/h3-10,13,18,25H,11-12,14H2,1-2H3 |
| InChIKey | HERHJRRTXUEJGY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |