C17H28N2O2Si2 — CID 140848439
5-ethyl-5-phenyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione (PubChem CID 140848439) has the molecular formula C17H28N2O2Si2 and a molecular weight of 348.60 g/mol. Its IUPAC name is 5-ethyl-5-phenyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-5-phenyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848439 |
| Molecular Formula | C17H28N2O2Si2 |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-ethyl-5-phenyl-1,3-bis(trimethylsilyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccccc2)C(=O)N([Si](C)(C)C)C(=O)N1[Si](C)(C)C |
| InChI | InChI=1S/C17H28N2O2Si2/c1-8-17(14-12-10-9-11-13-14)15(20)18(22(2,3)4)16(21)19(17)23(5,6)7/h9-13H,8H2,1-7H3 |
| InChIKey | HMLBPNLNBHLYCO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|