About CID 140661340
CID 140661340 (PubChem CID 140661340) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol.
Molecular Properties
| Compound Name | CID 140661340 |
| PubChem CID | 140661340 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C1[C]C(C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H24/c1-16(2,3)14-11-15(17(4,5)6)13-10-8-7-9-12(13)14/h7-10,14-15H,1-6H3 |
| InChIKey | BVUIVISUOJPTIV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 140661340 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140661340?
The IUPAC name of CID 140661340 (CID 140661340) is not available.
What is the SMILES notation for CID 140661340?
The canonical SMILES for CID 140661340 is CC(C)(C)C1[C]C(C(C)(C)C)c2ccccc21.
What is the InChIKey of CID 140661340?
The InChIKey is BVUIVISUOJPTIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24/c1-16(2,3)14-11-15(17(4,5)6)13-10-8-7-9-12(13)14/h7-10,14-15H,1-6H3.
What are the key properties of CID 140661340?
CID 140661340 has a molecular weight of 228.38 g/mol, XLogP of 5.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140661340 is sourced from PubChem (CID 140661340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).