C20H15ClO3 — CID 14809978
5-(4-chlorophenyl)-3,3-diphenyl-1,2,4-trioxolane (PubChem CID 14809978) has the molecular formula C20H15ClO3 and a molecular weight of 338.79 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3,3-diphenyl-1,2,4-trioxolane.
| Compound Name | 5-(4-chlorophenyl)-3,3-diphenyl-1,2,4-trioxolane |
|---|---|
| PubChem CID | 14809978 |
| Molecular Formula | C20H15ClO3 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 5-(4-chlorophenyl)-3,3-diphenyl-1,2,4-trioxolane |
| SMILES | Clc1ccc(C2OOC(c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H15ClO3/c21-18-13-11-15(12-14-18)19-22-20(24-23-19,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-14,19H |
| InChIKey | YHPKCBPOIISZGD-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|