C15H12O3 — CID 101035570
(1S,9R)-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (PubChem CID 101035570) has the molecular formula C15H12O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is (1S,9R)-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene.
| Compound Name | (1S,9R)-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 101035570 |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (1S,9R)-1-phenyl-10,11,12-trioxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| SMILES | c1ccc([C@]23OO[C@H](Cc4ccccc42)O3)cc1 |
| InChI | InChI=1S/C15H12O3/c1-2-7-12(8-3-1)15-13-9-5-4-6-11(13)10-14(16-15)17-18-15/h1-9,14H,10H2/t14-,15+/m1/s1 |
| InChIKey | KHDNTPOCKPHNJS-CABCVRRESA-N |
| XLogP | 2.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|