C11H12O3 — CID 12528114
1-phenyl-6,7,8-trioxabicyclo[3.2.1]octane (PubChem CID 12528114) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-phenyl-6,7,8-trioxabicyclo[3.2.1]octane.
| Compound Name | 1-phenyl-6,7,8-trioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 12528114 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1-phenyl-6,7,8-trioxabicyclo[3.2.1]octane |
| SMILES | c1ccc(C23CCCC(OO2)O3)cc1 |
| InChI | InChI=1S/C11H12O3/c1-2-5-9(6-3-1)11-8-4-7-10(12-11)13-14-11/h1-3,5-6,10H,4,7-8H2 |
| InChIKey | AIJQQAYDNHMZAD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|