C18H24O5 — CID 129396252
(1R,4R,7R)-4-cyclohexyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane (PubChem CID 129396252) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is (1R,4R,7R)-4-cyclohexyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane.
| Compound Name | (1R,4R,7R)-4-cyclohexyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane |
|---|---|
| PubChem CID | 129396252 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | (1R,4R,7R)-4-cyclohexyl-1-phenyl-2,3,5,6,11-pentaoxabicyclo[5.3.1]undecane |
| SMILES | c1ccc([C@@]23CCC[C@@H](OO[C@@H](C4CCCCC4)OO2)O3)cc1 |
| InChI | InChI=1S/C18H24O5/c1-3-8-14(9-4-1)17-21-20-16-12-7-13-18(19-16,23-22-17)15-10-5-2-6-11-15/h2,5-6,10-11,14,16-17H,1,3-4,7-9,12-13H2/t16-,17-,18-/m1/s1 |
| InChIKey | HSQFXKDGUVDNOX-KZNAEPCWSA-N |
| XLogP | 4.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|