C26H28BNO — CID 59883196
(4R)-4-cyclohexyl-2,5,5-triphenyl-1,3,2-oxazaborolidine (PubChem CID 59883196) has the molecular formula C26H28BNO and a molecular weight of 381.33 g/mol. Its IUPAC name is (4R)-4-cyclohexyl-2,5,5-triphenyl-1,3,2-oxazaborolidine.
| Compound Name | (4R)-4-cyclohexyl-2,5,5-triphenyl-1,3,2-oxazaborolidine |
|---|---|
| PubChem CID | 59883196 |
| Molecular Formula | C26H28BNO |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | (4R)-4-cyclohexyl-2,5,5-triphenyl-1,3,2-oxazaborolidine |
| SMILES | c1ccc(B2N[C@H](C3CCCCC3)C(c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C26H28BNO/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22,23-17-9-3-10-18-23)29-27(28-25)24-19-11-4-12-20-24/h2-4,7-12,15-21,25,28H,1,5-6,13-14H2/t25-/m1/s1 |
| InChIKey | UEROYZILYZPGED-RUZDIDTESA-N |
| XLogP | 4.89 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|