C12H15BO2 — CID 124629415
(3aR,7aR)-2-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole (PubChem CID 124629415) has the molecular formula C12H15BO2 and a molecular weight of 202.06 g/mol. Its IUPAC name is (3aR,7aR)-2-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole.
| Compound Name | (3aR,7aR)-2-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole |
|---|---|
| PubChem CID | 124629415 |
| Molecular Formula | C12H15BO2 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (3aR,7aR)-2-phenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaborole |
| SMILES | c1ccc(B2O[C@@H]3CCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C12H15BO2/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12-/m1/s1 |
| InChIKey | NCNFRQNIFWKJTB-VXGBXAGGSA-N |
| XLogP | 1.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|