C24H25O2P — CID 13494364
(3aR,7aS)-2,2,2-triphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole (PubChem CID 13494364) has the molecular formula C24H25O2P and a molecular weight of 376.44 g/mol. Its IUPAC name is (3aR,7aS)-2,2,2-triphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole.
| Compound Name | (3aR,7aS)-2,2,2-triphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole |
|---|---|
| PubChem CID | 13494364 |
| Molecular Formula | C24H25O2P |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (3aR,7aS)-2,2,2-triphenyl-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxaphosphole |
| SMILES | c1ccc(P2(c3ccccc3)(c3ccccc3)O[C@H]3CCCC[C@H]3O2)cc1 |
| InChI | InChI=1S/C24H25O2P/c1-4-12-20(13-5-1)27(21-14-6-2-7-15-21,22-16-8-3-9-17-22)25-23-18-10-11-19-24(23)26-27/h1-9,12-17,23-24H,10-11,18-19H2/t23-,24+ |
| InChIKey | PHCRVFHQYFXFGG-PSWAGMNNSA-N |
| XLogP | 4.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|