C22H19O4P — CID 133053627
2,2,2-triphenyl-1,3,2λ5-dioxaphosphepane-4,7-dione (PubChem CID 133053627) has the molecular formula C22H19O4P and a molecular weight of 378.36 g/mol. Its IUPAC name is 2,2,2-triphenyl-1,3,2λ5-dioxaphosphepane-4,7-dione.
| Compound Name | 2,2,2-triphenyl-1,3,2λ5-dioxaphosphepane-4,7-dione |
|---|---|
| PubChem CID | 133053627 |
| Molecular Formula | C22H19O4P |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2,2,2-triphenyl-1,3,2λ5-dioxaphosphepane-4,7-dione |
| SMILES | O=C1CCC(=O)OP(c2ccccc2)(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C22H19O4P/c23-21-16-17-22(24)26-27(25-21,18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | NQBITKHSRXXOAB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|