About 5-phenyl-5λ5-phosphaspiro[4.4]nonane
5-phenyl-5λ5-phosphaspiro[4.4]nonane (PubChem CID 23419870) has the molecular formula C14H21P
and a molecular weight of 220.30 g/mol. Its IUPAC name is 5-phenyl-5λ5-phosphaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 5-phenyl-5λ5-phosphaspiro[4.4]nonane |
| PubChem CID | 23419870 |
| Molecular Formula | C14H21P |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 5-phenyl-5λ5-phosphaspiro[4.4]nonane |
| SMILES | c1ccc(P23(CCCC2)CCCC3)cc1 |
| InChI | InChI=1S/C14H21P/c1-2-8-14(9-3-1)15(10-4-5-11-15)12-6-7-13-15/h1-3,8-9H,4-7,10-13H2 |
| InChIKey | JZOWWMQXLQYWDI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyl-5λ5-phosphaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-5λ5-phosphaspiro[4.4]nonane?
The IUPAC name of 5-phenyl-5λ5-phosphaspiro[4.4]nonane (CID 23419870) is 5-phenyl-5λ5-phosphaspiro[4.4]nonane.
What is the SMILES notation for 5-phenyl-5λ5-phosphaspiro[4.4]nonane?
The canonical SMILES for 5-phenyl-5λ5-phosphaspiro[4.4]nonane is c1ccc(P23(CCCC2)CCCC3)cc1.
What is the InChIKey of 5-phenyl-5λ5-phosphaspiro[4.4]nonane?
The InChIKey is JZOWWMQXLQYWDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21P/c1-2-8-14(9-3-1)15(10-4-5-11-15)12-6-7-13-15/h1-3,8-9H,4-7,10-13H2.
What are the key properties of 5-phenyl-5λ5-phosphaspiro[4.4]nonane?
5-phenyl-5λ5-phosphaspiro[4.4]nonane has a molecular weight of 220.30 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-5λ5-phosphaspiro[4.4]nonane is sourced from PubChem (CID 23419870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).