C12H17O4P — CID 23417083
6-phenyl-1,5,7,11-tetraoxa-6λ5-phosphaspiro[5.5]undecane (PubChem CID 23417083) has the molecular formula C12H17O4P and a molecular weight of 256.24 g/mol. Its IUPAC name is 6-phenyl-1,5,7,11-tetraoxa-6λ5-phosphaspiro[5.5]undecane.
| Compound Name | 6-phenyl-1,5,7,11-tetraoxa-6λ5-phosphaspiro[5.5]undecane |
|---|---|
| PubChem CID | 23417083 |
| Molecular Formula | C12H17O4P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 6-phenyl-1,5,7,11-tetraoxa-6λ5-phosphaspiro[5.5]undecane |
| SMILES | c1ccc(P23(OCCCO2)OCCCO3)cc1 |
| InChI | InChI=1S/C12H17O4P/c1-2-6-12(7-3-1)17(13-8-4-9-14-17)15-10-5-11-16-17/h1-3,6-7H,4-5,8-11H2 |
| InChIKey | TYEBCWFHSDPYMD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|