C12H19O4P — CID 23418788
2,2-diethoxy-2-phenyl-1,3,2λ5-dioxaphospholane (PubChem CID 23418788) has the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. Its IUPAC name is 2,2-diethoxy-2-phenyl-1,3,2λ5-dioxaphospholane.
| Compound Name | 2,2-diethoxy-2-phenyl-1,3,2λ5-dioxaphospholane |
|---|---|
| PubChem CID | 23418788 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 2,2-diethoxy-2-phenyl-1,3,2λ5-dioxaphospholane |
| SMILES | CCOP1(OCC)(c2ccccc2)OCCO1 |
| InChI | InChI=1S/C12H19O4P/c1-3-13-17(14-4-2,15-10-11-16-17)12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3 |
| InChIKey | YSMKQADHAOXMHX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|