C16H27O2P — CID 23413639
1,1-diethoxy-2,2,3-trimethyl-1-phenyl-1λ5-phosphetane (PubChem CID 23413639) has the molecular formula C16H27O2P and a molecular weight of 282.36 g/mol. Its IUPAC name is 1,1-diethoxy-2,2,3-trimethyl-1-phenyl-1λ5-phosphetane.
| Compound Name | 1,1-diethoxy-2,2,3-trimethyl-1-phenyl-1λ5-phosphetane |
|---|---|
| PubChem CID | 23413639 |
| Molecular Formula | C16H27O2P |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1,1-diethoxy-2,2,3-trimethyl-1-phenyl-1λ5-phosphetane |
| SMILES | CCOP1(OCC)(c2ccccc2)CC(C)C1(C)C |
| InChI | InChI=1S/C16H27O2P/c1-6-17-19(18-7-2,13-14(3)16(19,4)5)15-11-9-8-10-12-15/h8-12,14H,6-7,13H2,1-5H3 |
| InChIKey | SUHFJHKTVHIKAU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|