C13H16N2O2 — CID 64884255
3,7-dimethyl-3-phenyl-1,4-diazepane-2,5-dione (PubChem CID 64884255) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 3,7-dimethyl-3-phenyl-1,4-diazepane-2,5-dione.
| Compound Name | 3,7-dimethyl-3-phenyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64884255 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3,7-dimethyl-3-phenyl-1,4-diazepane-2,5-dione |
| SMILES | CC1CC(=O)NC(C)(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C13H16N2O2/c1-9-8-11(16)15-13(2,12(17)14-9)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | YWOVRKBOSMUYGC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |