C11H11NO2 — CID 91421764
(5S)-5-methyl-5-phenylpyrrolidine-2,4-dione (PubChem CID 91421764) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (5S)-5-methyl-5-phenylpyrrolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-phenylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 91421764 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (5S)-5-methyl-5-phenylpyrrolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)CC1=O |
| InChI | InChI=1S/C11H11NO2/c1-11(8-5-3-2-4-6-8)9(13)7-10(14)12-11/h2-6H,7H2,1H3,(H,12,14)/t11-/m0/s1 |
| InChIKey | DFUUYTMXEWFKAH-NSHDSACASA-N |
| XLogP | 0.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|