C15H15N3O2S — CID 64965769
3-methyl-3-phenyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione (PubChem CID 64965769) has the molecular formula C15H15N3O2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 3-methyl-3-phenyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3-methyl-3-phenyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64965769 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-methyl-3-phenyl-1-(1,3-thiazol-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CC1(c2ccccc2)NC(=O)CN(Cc2nccs2)C1=O |
| InChI | InChI=1S/C15H15N3O2S/c1-15(11-5-3-2-4-6-11)14(20)18(9-12(19)17-15)10-13-16-7-8-21-13/h2-8H,9-10H2,1H3,(H,17,19) |
| InChIKey | AJYHUEABZXKOSS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |