C16H16N2O2S — CID 64881353
3-methyl-3-phenyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione (PubChem CID 64881353) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 3-methyl-3-phenyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3-methyl-3-phenyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64881353 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-methyl-3-phenyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CC1(c2ccccc2)NC(=O)CN(Cc2cccs2)C1=O |
| InChI | InChI=1S/C16H16N2O2S/c1-16(12-6-3-2-4-7-12)15(20)18(11-14(19)17-16)10-13-8-5-9-21-13/h2-9H,10-11H2,1H3,(H,17,19) |
| InChIKey | QKUNGOYFWICRPZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |