C12H16N2O2S — CID 64882918
3-ethyl-3-methyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione (PubChem CID 64882918) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-ethyl-3-methyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | 3-ethyl-3-methyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64882918 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-ethyl-3-methyl-1-(thiophen-2-ylmethyl)piperazine-2,5-dione |
| SMILES | CCC1(C)NC(=O)CN(Cc2cccs2)C1=O |
| InChI | InChI=1S/C12H16N2O2S/c1-3-12(2)11(16)14(8-10(15)13-12)7-9-5-4-6-17-9/h4-6H,3,7-8H2,1-2H3,(H,13,15) |
| InChIKey | SQDCUEGUYWMLEE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |