C15H23O5P — CID 23413150
2,2,2-triethoxy-4-methyl-5-phenyl-1,3,2λ5-dioxaphosphole (PubChem CID 23413150) has the molecular formula C15H23O5P and a molecular weight of 314.32 g/mol. Its IUPAC name is 2,2,2-triethoxy-4-methyl-5-phenyl-1,3,2λ5-dioxaphosphole.
| Compound Name | 2,2,2-triethoxy-4-methyl-5-phenyl-1,3,2λ5-dioxaphosphole |
|---|---|
| PubChem CID | 23413150 |
| Molecular Formula | C15H23O5P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2,2,2-triethoxy-4-methyl-5-phenyl-1,3,2λ5-dioxaphosphole |
| SMILES | CCOP1(OCC)(OCC)OC(C)=C(c2ccccc2)O1 |
| InChI | InChI=1S/C15H23O5P/c1-5-16-21(17-6-2,18-7-3)19-13(4)15(20-21)14-11-9-8-10-12-14/h8-12H,5-7H2,1-4H3 |
| InChIKey | YMNPWISEMKBKFP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|