C26H37NO2 — CID 143193631
2,6-diethyl-2,3,6-trimethyl-4,4-bis(phenylmethoxy)piperidine (PubChem CID 143193631) has the molecular formula C26H37NO2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 2,6-diethyl-2,3,6-trimethyl-4,4-bis(phenylmethoxy)piperidine.
| Compound Name | 2,6-diethyl-2,3,6-trimethyl-4,4-bis(phenylmethoxy)piperidine |
|---|---|
| PubChem CID | 143193631 |
| Molecular Formula | C26H37NO2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | 2,6-diethyl-2,3,6-trimethyl-4,4-bis(phenylmethoxy)piperidine |
| SMILES | CCC1(C)CC(OCc2ccccc2)(OCc2ccccc2)C(C)C(C)(CC)N1 |
| InChI | InChI=1S/C26H37NO2/c1-6-24(4)20-26(21(3)25(5,7-2)27-24,28-18-22-14-10-8-11-15-22)29-19-23-16-12-9-13-17-23/h8-17,21,27H,6-7,18-20H2,1-5H3 |
| InChIKey | KEQGMJODSLVRLB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|