C13H12N2O5 — CID 146279077
benzyl 2-(2,4,6-trioxo-1,3-diazinan-5-yl)acetate (PubChem CID 146279077) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is benzyl 2-(2,4,6-trioxo-1,3-diazinan-5-yl)acetate.
| Compound Name | benzyl 2-(2,4,6-trioxo-1,3-diazinan-5-yl)acetate |
|---|---|
| PubChem CID | 146279077 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | benzyl 2-(2,4,6-trioxo-1,3-diazinan-5-yl)acetate |
| SMILES | O=C1NC(=O)C(CC(=O)OCc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C13H12N2O5/c16-10(20-7-8-4-2-1-3-5-8)6-9-11(17)14-13(19)15-12(9)18/h1-5,9H,6-7H2,(H2,14,15,17,18,19) |
| InChIKey | IWELAZFTWOKAAR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|