C17H21NO3 — CID 70455479
benzyl 2-(2-oxo-1,3,3a,4,5,6,7,7a-octahydroindol-3-yl)acetate (PubChem CID 70455479) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is benzyl 2-(2-oxo-1,3,3a,4,5,6,7,7a-octahydroindol-3-yl)acetate.
| Compound Name | benzyl 2-(2-oxo-1,3,3a,4,5,6,7,7a-octahydroindol-3-yl)acetate |
|---|---|
| PubChem CID | 70455479 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | benzyl 2-(2-oxo-1,3,3a,4,5,6,7,7a-octahydroindol-3-yl)acetate |
| SMILES | O=C(CC1C(=O)NC2CCCCC21)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c19-16(21-11-12-6-2-1-3-7-12)10-14-13-8-4-5-9-15(13)18-17(14)20/h1-3,6-7,13-15H,4-5,8-11H2,(H,18,20) |
| InChIKey | ARFHZBQECOOCGK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |