C18H24N2O3 — CID 42426678
benzyl 2-[(2R)-1-cyclopentyl-3-oxopiperazin-2-yl]acetate (PubChem CID 42426678) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is benzyl 2-[(2R)-1-cyclopentyl-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[(2R)-1-cyclopentyl-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 42426678 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | benzyl 2-[(2R)-1-cyclopentyl-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(C[C@@H]1C(=O)NCCN1C1CCCC1)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O3/c21-17(23-13-14-6-2-1-3-7-14)12-16-18(22)19-10-11-20(16)15-8-4-5-9-15/h1-3,6-7,15-16H,4-5,8-13H2,(H,19,22)/t16-/m1/s1 |
| InChIKey | PHSWZWFASXLWPK-MRXNPFEDSA-N |
| XLogP | 1.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |