C24H29N3O2 — CID 42240993
N-benzhydryl-2-[(2S)-1-cyclopentyl-3-oxopiperazin-2-yl]acetamide (PubChem CID 42240993) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-benzhydryl-2-[(2S)-1-cyclopentyl-3-oxopiperazin-2-yl]acetamide.
| Compound Name | N-benzhydryl-2-[(2S)-1-cyclopentyl-3-oxopiperazin-2-yl]acetamide |
|---|---|
| PubChem CID | 42240993 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-benzhydryl-2-[(2S)-1-cyclopentyl-3-oxopiperazin-2-yl]acetamide |
| SMILES | O=C(C[C@H]1C(=O)NCCN1C1CCCC1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c28-22(17-21-24(29)25-15-16-27(21)20-13-7-8-14-20)26-23(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-6,9-12,20-21,23H,7-8,13-17H2,(H,25,29)(H,26,28)/t21-/m0/s1 |
| InChIKey | WOEYXWIFUKFBPH-NRFANRHFSA-N |
| XLogP | 3.03 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |