C22H32N4O3 — CID 45196144
2-(1-cyclopentyl-3-oxopiperazin-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide (PubChem CID 45196144) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-(1-cyclopentyl-3-oxopiperazin-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide.
| Compound Name | 2-(1-cyclopentyl-3-oxopiperazin-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 45196144 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 2-(1-cyclopentyl-3-oxopiperazin-2-yl)-N-[(4-morpholin-4-ylphenyl)methyl]acetamide |
| SMILES | O=C(CC1C(=O)NCCN1C1CCCC1)NCc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H32N4O3/c27-21(15-20-22(28)23-9-10-26(20)19-3-1-2-4-19)24-16-17-5-7-18(8-6-17)25-11-13-29-14-12-25/h5-8,19-20H,1-4,9-16H2,(H,23,28)(H,24,27) |
| InChIKey | MEGOKMPVBGAYOF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|