C24H30N3O6P3 — CID 68558324
2,4,6-triethoxy-2,4,6-triphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 68558324) has the molecular formula C24H30N3O6P3 and a molecular weight of 549.44 g/mol. Its IUPAC name is 2,4,6-triethoxy-2,4,6-triphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,4,6-triethoxy-2,4,6-triphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 68558324 |
| Molecular Formula | C24H30N3O6P3 |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 2,4,6-triethoxy-2,4,6-triphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | CCOP1(Oc2ccccc2)=NP(OCC)(Oc2ccccc2)=NP(OCC)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C24H30N3O6P3/c1-4-28-34(31-22-16-10-7-11-17-22)25-35(29-5-2,32-23-18-12-8-13-19-23)27-36(26-34,30-6-3)33-24-20-14-9-15-21-24/h7-21H,4-6H2,1-3H3 |
| InChIKey | SHFRRGIYIRMMRA-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|