C20H40N4O8P4 — CID 139877917
2,2,4,4,6,6,8-heptaethoxy-8-phenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 139877917) has the molecular formula C20H40N4O8P4 and a molecular weight of 588.46 g/mol. Its IUPAC name is 2,2,4,4,6,6,8-heptaethoxy-8-phenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,2,4,4,6,6,8-heptaethoxy-8-phenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 139877917 |
| Molecular Formula | C20H40N4O8P4 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 2,2,4,4,6,6,8-heptaethoxy-8-phenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | CCOP1(OCC)=NP(OCC)(OCC)=NP(OCC)(Oc2ccccc2)=NP(OCC)(OCC)=N1 |
| InChI | InChI=1S/C20H40N4O8P4/c1-8-25-33(26-9-2)21-34(27-10-3,28-11-4)23-36(31-14-7,32-20-18-16-15-17-19-20)24-35(22-33,29-12-5)30-13-6/h15-19H,8-14H2,1-7H3 |
| InChIKey | ONUODWGFXBFCDF-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 123.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|