C36H30F6N6O6P6 — CID 59283717
2,4,6,8,10,12-hexafluoro-2,4,6,8,10,12-hexaphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene (PubChem CID 59283717) has the molecular formula C36H30F6N6O6P6 and a molecular weight of 942.50 g/mol. Its IUPAC name is 2,4,6,8,10,12-hexafluoro-2,4,6,8,10,12-hexaphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene.
| Compound Name | 2,4,6,8,10,12-hexafluoro-2,4,6,8,10,12-hexaphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 59283717 |
| Molecular Formula | C36H30F6N6O6P6 |
| Molecular Weight | 942.50 g/mol |
| Exact Mass | 942.06 |
| IUPAC Name | 2,4,6,8,10,12-hexafluoro-2,4,6,8,10,12-hexaphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
| SMILES | FP1(Oc2ccccc2)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C36H30F6N6O6P6/c37-55(49-31-19-7-1-8-20-31)43-56(38,50-32-21-9-2-10-22-32)45-58(40,52-34-25-13-4-14-26-34)47-60(42,54-36-29-17-6-18-30-36)48-59(41,53-35-27-15-5-16-28-35)46-57(39,44-55)51-33-23-11-3-12-24-33/h1-30H |
| InChIKey | BXKPPKWEHVBXDF-UHFFFAOYSA-N |
| XLogP | 17.97 |
| TPSA | 129.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.50 |
| LogP ≤ 5 | 17.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|