C28H45N9O3P4 — CID 23419417
2-N,2-N,2-N',2-N',4-N,4-N,6-N,6-N,8-N,8-N-decamethyl-4,6,8-triphenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,2,4,6,8-pentamine (PubChem CID 23419417) has the molecular formula C28H45N9O3P4 and a molecular weight of 679.62 g/mol. Its IUPAC name is 2-N,2-N,2-N',2-N',4-N,4-N,6-N,6-N,8-N,8-N-decamethyl-4,6,8-triphenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,2,4,6,8-pentamine.
| Compound Name | 2-N,2-N,2-N',2-N',4-N,4-N,6-N,6-N,8-N,8-N-decamethyl-4,6,8-triphenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,2,4,6,8-pentamine |
|---|---|
| PubChem CID | 23419417 |
| Molecular Formula | C28H45N9O3P4 |
| Molecular Weight | 679.62 g/mol |
| Exact Mass | 679.26 |
| IUPAC Name | 2-N,2-N,2-N',2-N',4-N,4-N,6-N,6-N,8-N,8-N-decamethyl-4,6,8-triphenoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,2,4,6,8-pentamine |
| SMILES | CN(C)P1(Oc2ccccc2)=NP(Oc2ccccc2)(N(C)C)=NP(N(C)C)(N(C)C)=NP(Oc2ccccc2)(N(C)C)=N1 |
| InChI | InChI=1S/C28H45N9O3P4/c1-33(2)41(34(3)4)29-42(35(5)6,38-26-20-14-11-15-21-26)31-44(37(9)10,40-28-24-18-13-19-25-28)32-43(30-41,36(7)8)39-27-22-16-12-17-23-27/h11-25H,1-10H3 |
| InChIKey | UZZFEECXPNTYBR-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 93.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.62 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|