C12H10Cl4N3O2P3 — CID 14366454
2,2,4,4-tetrachloro-6,6-diphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene (PubChem CID 14366454) has the molecular formula C12H10Cl4N3O2P3 and a molecular weight of 462.97 g/mol. Its IUPAC name is 2,2,4,4-tetrachloro-6,6-diphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2,4,4-tetrachloro-6,6-diphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 14366454 |
| Molecular Formula | C12H10Cl4N3O2P3 |
| Molecular Weight | 462.97 g/mol |
| Exact Mass | 460.87 |
| IUPAC Name | 2,2,4,4-tetrachloro-6,6-diphenoxy-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene |
| SMILES | ClP1(Cl)=NP(Cl)(Cl)=NP(Oc2ccccc2)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C12H10Cl4N3O2P3/c13-22(14)17-23(15,16)19-24(18-22,20-11-7-3-1-4-8-11)21-12-9-5-2-6-10-12/h1-10H |
| InChIKey | FANUSMOSIQERIX-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.97 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|