C30H25Cl3N4O5P4 — CID 15567408
2,2,6-trichloro-4,4,6,8,8-pentaphenoxy-1,3,5,7-tetraza-2lambda5,4lambda5,6lambda5,8lambda5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 15567408) has the molecular formula C30H25Cl3N4O5P4 and a molecular weight of 751.81 g/mol. Its IUPAC name is 2,2,6-trichloro-4,4,6,8,8-pentaphenoxy-1,3,5,7-tetraza-2lambda5,4lambda5,6lambda5,8lambda5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,2,6-trichloro-4,4,6,8,8-pentaphenoxy-1,3,5,7-tetraza-2lambda5,4lambda5,6lambda5,8lambda5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 15567408 |
| Molecular Formula | C30H25Cl3N4O5P4 |
| Molecular Weight | 751.81 g/mol |
| Exact Mass | 749.98 |
| IUPAC Name | 2,2,6-trichloro-4,4,6,8,8-pentaphenoxy-1,3,5,7-tetraza-2lambda5,4lambda5,6lambda5,8lambda5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | ClP1(Cl)=NP(Oc2ccccc2)(Oc2ccccc2)=NP(Cl)(Oc2ccccc2)=NP(Oc2ccccc2)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C30H25Cl3N4O5P4/c31-43(32)34-45(39-27-18-8-2-9-19-27,40-28-20-10-3-11-21-28)36-44(33,38-26-16-6-1-7-17-26)37-46(35-43,41-29-22-12-4-13-23-29)42-30-24-14-5-15-25-30/h1-25H |
| InChIKey | JSDDSJHTPXJDSL-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 95.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.81 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|